Answer:
Write this in a word and skeleton equation:
Solid silver chloride and an aqueous solution of nitric acid are produced when a solution of silver nitrate is reacted with a solution of hydrochloric acid.
Explanation:
Answer:
A) Sample B has more calcium carbonate molecules
Explanation:
M = Molar mass of calcium carbonate = 100.0869 g/mol
= Avogadro's number = 
For the 4.12 g sample
Moles of a substance is given by

Number of molecules is given by

For the 19.37 g sample

Number of molecules is given by


So, sample B has more calcium carbonate molecules.
The ratio of the elements of carbon, oxygen, calcium atoms, ions, has to be same in both the samples otherwise the samples cannot be considered as calcium carbonate. Same is applicable for impurities. If there are impurites then the sample cannot be considered as calcium carbonate.
The condensed formula would be CH3-CH(CH4)-CH2-CH(CH4)-CH2-CH(CH4)-CH3. The molecular formula would be C10H25.
Answer:
The answer is A. a wave of vibrating electric and magnetic energy.