All categories

2 years ago

Why does the chloride ion have a charge of -1

Chemistry

1 answer:

Alexandra [31]2 years ago

8 0

Explanation:

As we know that chloride ion is halogen. So it has seven valence electrons in its valence shell. Hence it gains one electron from others during chemical reaction to be stable. So Chloride ion have a negative charge of -1.

Hope it will help :)❤

You might be interested in

Write the equilibrium expression of each chemical equation. 2H2S(g) 2H2(g) + S2(g)

hodyreva [135]

Answer:

[H2]2[S2][H2S]2Kc=[H2]2[S2][H2S]2

Explanation:

2H2S(g)⇋2H2(g)+S2(g)2H2S(g)⇋2H2(g)+S2(g)

The equilibrium constant expression in terms of concentrations is:

Kc=[H2]2[S2][H2S]2Kc=[H2]2[S2][H2S]2.

6 0

3 years ago

Omg GUYS I NEED HELPPP

Ilia_Sergeevich [38]

27) Partial pressure of oxygen: 57.8 kPa

29) Final volume: 80 mL

30) Final volume: 8987 L

31) Due to property of water of being polar, ice floats on water

Explanation:

27)

In a mixture of gases, the total pressure of the mixture is the sum of the partial pressures:

$p_T = p_1 + p_2 + ... + p_N$

In this problem, the mixture contains 3 gases (helium, carbon dioxide and oxygen). We know that the total pressure is

$p_T=201.4 kPa$

We also know the partial pressures of helium and carbon dioxide:

$P_{He}=125.4 kPa\\P_{CO_2}=18.2 kPa$

The total pressure can be written as

$p_T=p_{He}+p_{CO_2}+p_{O_2}$

where $p_{O_2}$ is the partial pressure of oxygen. Therefore, we find

$p_{O_2}=p_T-p_{He}-p_{CO_2}=201.4-125.4-18.2=57.8 kPa$

29)

Assuming that the pressure of the gas is constant, we can apply Charle's law, which states that:

"For an ideal gas at constant pressure, the volume of the gas is proportional to its absolute temperature"

Mathematically,

$\frac{V}{T}=const.$

where

V is the volume of the gas

T is the Kelvin temperature

We can re-write it as

$\frac{V_1}{T_1}=\frac{V_2}{T_2}$

Here we have:

$V_1 = 42 mL$ (initial volume)

$T_1=-89^{\circ}C+273=184 K$ is the initial temperature

$T_2=77^{\circ}C+273=350 K$ is the final temperature

Solving for V2, we find the final volume:

$V_2=\frac{V_1 T_2}{T_1}=\frac{(42)(350)}{184}=80 mL$

30)

For this problem, we can use the equation of state for ideal gases, which can be written as

$\frac{p_1 V_1}{T_1}=\frac{p_2 V_2}{T_2}$

where in this problem:

$p_1 = 102.3 kPa$ is the initial pressure

$V_1=1975 L$ is the initial volume

$T_1=25^{\circ}C+273=298 K$ is the initial temperature

$p_2=21.5 kPa$ is the final pressure

$T_2=12^{\circ}C+273=285 K$ is the final temperature

And solving for V2, we find the final volume of the balloon:

$V_2=\frac{p_1 V_1 T_2}{p_2 T_1}=\frac{(102.3)(1975)(285)}{(21.5)(298)}=8987 L$

31)

A molecule of water consists of two atoms hydrogen bond with an atom of oxygen ( $H_2 O$ ) in a covalent bond.

While the molecul of water is overall neutral, due to the higher electronegativity of the oxygen atom, electrons are slightly shifted towards the oxygen atom; as a result, there is a slightly positive charge on the hydrogen side, and a slightly negative charge on the oxygen side (so, the molecules is said to be polar).

As a consequence, molecules of water attract each other, forming the so-called "hydrogen bonds".

One direct consequence of the polarity of water is that ice floats on liquid water.

Normally, for every substance on Earth, the solid state is more dense than the liquid state. However, this is not true for water, because ice is less dense than liquid water.

This is due to the polarity of water. In fact, when the temperature of water is decreased to freezing point and water becomes ice, the hydrogen bondings "force" the molecules to arrange in a lattice structure, so that the molecules become more spaced when they turn into solid state. As a result, ice occupies more volume than water, and therefore it is less dense, being able to float on water.

Learn more about ideal gases:

brainly.com/question/9321544

brainly.com/question/7316997

brainly.com/question/3658563

#LearnwithBrainly

4 0

3 years ago

What is the formula ofchromium(III) hydrogensulfate?

FromTheMoon [43]

Answer:

Cr (HSO4)3

Explanation:

its molecular weight is 343.20 g/mol

its molecular formula can also be written as CrH3O12S3

molar mass of Cr (HSO4)3 can be calculated by following method;

atomic mass of Cr = 51.9961 u

atomic mass of H = 1 u

atomic mass of S = 32.065 u

atomic mass of O = 16 u

molar mass of Cr(HSO4)3 = 51.9961+ 1.00784×3 + 32.065×3 + 15.999×12

molar mass of Cr(HSO4)3 =51.9961+3.02352+96.195+ 191.988

molar mass of Cr(HSO4)3 = 343.20 g/mol

3 0

3 years ago

Platinum crystallizes with the face-centered cubic unit cell. The radius of a platinum atom is 139 pm. Calculate the edge length

horrorfan [7]

Answer:

Length = 393pm, Density = 21.3 g/cm^3.

Explanation:

From the question above, we have the following parameters or data which is going to aid in solving the above Question.

=> The radius of a platinum atom = 139 pm.

Therefore, the length can be calculated by making use of the formula given below:

Length = 2 √( 2r) = 2 × √ (2 × 139 × 10^-12m ) = 393 × 10^-10 m = 393pm.

The density can be calculated by making use of the chemical formula given below:

Density = mass ÷ volume = (195.064/ 6.02 × 10^23) ÷ (3.93 × 10^-10/ 10^-2) = 21.3 g/cm^3.

3 0

3 years ago

According to the combined gas law, the pressure exerted by a gas is:

sergij07 [2.7K]

Answer : The correct option is, (d) inversely proportional to volume and directly proportional to the kelvin temperature

Explanation :

Boyle's Law : It is defined as the pressure of the gas is inversely proportional to the volume of the gas at constant temperature and number of moles.

$P\propto \frac{1}{V}$

Charles' Law : It is defined as the volume of the gas is directly proportional to the temperature of the gas at constant pressure and number of moles.

$V\propto T$

Gay-Lussac's Law : It is defined as the pressure of the gas is directly proportional to the temperature of the gas at constant volume and number of moles.

$P\propto T$

Combined gas law : It is the combination of Boyle's law, Charles's law and Gay-Lussac's law.

The combined gas equation is,

$\frac{PV}{T}=K$

or,

$\frac{P_1V_1}{T_1}=\frac{P_2V_2}{T_2}$

From the above information we conclude that the pressure exerted by a gas is inversely proportional to volume and directly proportional to the kelvin temperature.

Hence, the correct option is, (d)

3 0

3 years ago