Your answer would be answer choice D. The ball is accelerating as the velocity is increasing at a constant rate.
Hope this helps,
♥<em /><em>A.W.E.<u>S.W.A.N.</u></em>♥
Answer/ explanation :
Protist can be multicellular or unicellular organisms
Plants are all multicellular and also exhibit cellular differentiation.
Protist can be autotroph, heterotrophic or decomposer
Plants are only autotrophs because they manufacture their own food through photosynthesis
Protists are microscopic, more diverse and abundant in nature
Plants are big and complex in nature
Nuclear DNA strands in plants are of higher complexity than those of protist
Plants require oxygen for cellular respiration process unlike protist which can be aerobic and some other species facultative anaerobic
Plants only can reproduce asexually through bulbs and tubers as in yam, potatoes while protists reproduce either sexually through meiosis or asexually through simple cell division.
The forces of attraction between particles in their gaseous state seems to be nonexistential.
therefore scientist would care less. however another state after gas which is plasma has a lesser force of attraction than the gaseous state.
Answer:
pH = 4.543
Explanation:
- CH3CH2COOH + H2O ↔ CH3CH2COO- + H3O+
- pKa = - Log Ka
∴ Ka = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
∴ pKa = 4.87
⇒ Ka = 1.349 E-5 = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
added 300 mL 0f 0.02 M NaOH:
⇒ <em>C</em> CH3CH2COOH = ((0.200 L)(0.15 M)) - ((0.300 L)(0.02 M))/(0.3 + 0.2)
⇒ <em>C</em> CH3CH2COOH = 0.048 M
⇒ <em>C</em> NaOH = (0.300 L)(0.02 M) / (0.3 +0.2) = 0.012 M
mass balance:
⇒ 0.048 + 0.012 = 0.06 M = [CH3CH2COO-] + [CH3CH2COOH].......(1)
charge balance:
⇒ [H3O+] + [Na+] = [CH3CH2COO-]
∴ [Na+] = 0.02 M
⇒ [CH3CH2COO-] = [H3O+] + 0.02 M.............(2)
(2) in (1):
⇒ [CH3CH2COOH] = 0.06 M - 0.02 M - [H3O+] = 0.04 M - [H3O+]
replacing in Ka:
⇒ 1.349 E-5 = [H3O+][([H3O+] + 0.02) / (0.04 - [H3O+])
⇒ (1.349 E-5)(0.04 - [H3O+]) = [H3O+]² + 0.02[H3O+]
⇒ 5.396 E-7 - 1.349 E-5[H3O+] = [H3O+]² + 0.02[H3O+]
⇒ [H3O+]² + 0.02001[H3O+] - 5.396 E-7 = 0
⇒ [H3O+ ] = 2.867 E-5 M
∴ pH = - Log [H3O+]
⇒ pH = 4.543
Answer:
The International Date Line, established in 1884, passes through the mid-Pacific Ocean and roughly follows a 180 degrees longitude north-south line on the Earth. It is located halfway round the world from the prime meridian—the zero degrees longitude established in Greenwich, England, in 1852.
