Answer is: <span>because dissolved compounds can crystallizing from solution during filtration and forming crystals on the filter paper or funnel.
</span>Recrystallization<span> is a technique used to purify chemicals by dissolving both impurities and a compound in an appropriate solvent, either compound or impurities can be removed from the solution, leaving the other behind.</span>
Answer:
Look at the picture.
Explanation:
(2S,3S)-2-Bromo-3-phenylbutane will undergo E2 reaction and form trans product of elimination due to its thermodynamic stability.
The second one is the way to go.
It creates chlorofluorocarbons(CFCs) also would create biooxygen but in the multiple choice it only shows the CFCs