The compound is made of 2 oxygen molecules and the oxygen made of 20.61% its mass. If the molar mass of oxygen is 16, the molar mass of the compound will be:
2* oxygen* (16g/mol / oxygen) = 20.61% compound mass
compound mass= 32g/mol / 20.61%
compound mass= 155.26 g/mol
For this reaction, the mass of carbon dioxide and glucose involved are the product of thier molar mass and the number of moles of each compound involved in the reaction.
carbon dioxide: 6 x (12 + 2 x 16) = 264
glucose : 1 x (6 x 12 + 12 + 6 x 16) = 180
Divide their masses to get the equivalent weights. The answer is 22/15 or 11/7.5.
<span>Answer:
Pb(NO3)2+2HCl=PbCl2+2HNO3
Step 2
Find # of moles of Pb
13.87g Pb(NO3)2 x 1 mol/331.22=.041875 mol Pb(NO3)2
Step 3
Use balanced equation to find weight of Pb(NO3)2
.041875mol Pb x 1 mol Cl2/1mol Pb x 70.90g/1 mol Cl2=2.9689g Cl2
.041875 mol Pb x 207.2/1mol Pb=8.6765g Pb
=11.65g</span>
Answer:
See the answer below
Explanation:
The cross that would produce the maximum number of offspring with green sea pods would be:
1. GG x GG, or
2. GG x gg
The first one would produce all green offspring with homzygous genotypes as follows:
GG x GG
GG GG GG GG
The second cross would produce all green offspring with heterozygous genotypes as follows:
GG x gg
Gg Gg Gg Gg
Answer:
Pb2+ (aq) & 2Br- (aq) --> PbBr2 (s).
Explanation:
Equation of the reaction:
Pb(C2H32O2)2 (aq) + 2 NH4Br (aq) --> 2NH4C2H3O2 (aq) + PbBr2 (s)
Ionic equation:
Pb+2(aq) + 2(C2H3O2)-1 (aq) + 2(NH4+) (aq) + 2Br-1 (aq) --> 2(NH4+) (aq) + 2(C2H3O2-) (aq) + PbBr2 (s)
2(NH4)+1(aq) & 2(C2H3O2)-1 (aq) cancel out from both sides, you are left with the net ionic equation :
Pb2+ (aq) & 2Br- (aq) --> PbBr2 (s).
