<span>0.70 mol/0.250 L = 2.8 M</span>
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
The answer is
2Ag+(aq) + SO4-2(aq) → Ag2SO4(s)
<span>NO3- and K+ ions are spectators </span>
Answer: Option (b) is the correct answer.
Explanation:
State of a substance changes when heat is provided to a substance.
This is because when we heat water then intermoleclar forces present within its molecules tend to break down. Due to this molecules start to move away from each other.
As a result, kinetic energy of molecules increases and they collide rapidly. Hence, solid state of water changes into liquid state and upon excessive heating liquid state of water changes into vapor state.
Thus, we conclude that temperature of water needs to change in order to change its state of matter.
In a 0.01 M solution of HCl, Litmus will be red. Litmus paper will turn into red in acidic conditions. Hydrochloric acid is an acid. Litmus is an indicator for acidity and alkalinity made from inchens.
