A controlled experiment is one in which evrerything is held constant except for one verieble, maybe is usually a st of data is taken for a control group.
Answer:
1.1 percent
Explanation:
C6H5COOH⇌C6H5COO+H
Ka = [C6H5COO-][H+]/[C6H5COOH]
From pKa of 4.2, Ka = 6.3x10^-5
6.3x10^-5 = (x)(x)/0.51-x and assuming x is small...
6.3x10^-5 = x^2/0.51
x^2 = 3.213x10^-5
x =5.67 x10^-3
(5.67x10^-3/0.51)x 100 =1.1 percent
Answer:
Compound
Explanation:
A compound is a substance that cannot be broken down by an ordinary physical process but can be split into its component elements by chemical processes such as decomposition, dissociation, displacement.
A compound is made up of two or more different atoms. A particular compound is unique/uniform in its composition and doesn't share its particular composition with another compound. For example, carbon monoxide (CO) is made up of one atom of carbon and one atom of oxygen while carbon dioxide (CO₂) is made up of one atom of carbon and two atoms of oxygen.
According to this formula :
ΔTf= i Kf m
i is van't Hoff factor= 1
Kf = 1.86
m the molality we need to assume it
m= x moles of C2H5OH / Kg of mass
∴ 15 = 1 * 1.86 * ( x moles of C2H5OH/ 0.45 kg)
∴X = 3.629 moles
mass = no.of moles x molar mass of C2H5OH
= 3.629 X 46 = 167 g
∴the volume = mass / denisty
= 167 / 0.7893 = 211.57≈ 212 mL
Answer:
yes that is the name for the formula is magnesium diiodide