Answer is: household ammonia has 10 times higher H⁺ concentration.
1) pH(household ammonia) = 11.5.
pH = -log[H⁺], approximately the negative of the base 10 logarithm of the molar concentration of hydrogen ions.
[H⁺] = 10∧(-pH).
[H⁺] = 10∧(-11.5).
[H⁺] = 3.16·10⁻¹² M; concentration of hydrogen ions.
2) pH(household bleach) = 12.5.
[H⁺] = 10∧(-12.5).
[H⁺] = 3.16·10⁻¹³ M.
3) 3.16·10⁻¹² M / 3.16·10⁻¹³ M = 10.
Answer:
53.29%
Explanation:
The molar mass of C2H4O2 is 60.05g and the 2 O's are 32.00g
so 32.00/60.05= 0.53288925895
and that as a decimal rounded to the nearest hundredths is 53.29%
Answer:“If we’ve covered all of the potential sources, and we know the unique signature of the sand from these different sources, and we find it on a beach somewhere, then we basically know where it came from,” explained Barnard.
Explanation:
2,3,5-trimethylhexane
C9H20
Molecular weight= 128.5g/mol
CH3-CH(CH3)-CH(CH3)-CH2-CH(CH3)-CH3
Answer:
121 g/mol
Explanation:
To find the molar mass, you first need to calculate the number of moles. For this, you need to use the Ideal Gas Law. The equation looks like this:
PV = nRT
In this equation,
-----> P = pressure (atm)
-----> V = volume (L)
-----> n = moles
-----> R = constant (0.0821 L*atm/mol*K)
-----> T = temperature (K)
Because density is comparing the mass per 1 liter, I am assuming that the system has a volume of 1 L. Before you can plug the given values into the equation, you first need to convert Celsius to Kelvin.
P = 1.00 atm R = 0.0821 L*atm/mol*K
V = 1.00 L T = 25.0. °C + 273.15 = 298.15 K
n = ? moles
PV = nRT
(1.00 atm)(1.00L) = n(0.0821 L*atm/mol*K)(298.15 K)
1.00 = n(0.0821 L*atm/mol*K)(298.15 K)
1.00 = (24.478115)n
0.0409 = n
Now, we need to find the molar mass using the number of moles per liter (calculated) and the density.
0.0409 moles ? grams 4.95 grams
---------------------- x ------------------ = ------------------
1 L 1 mole 1 L
? g/mol = 121 g/mol
**note: I am not 100% confident on this answer
