Azane
And it's Molar Mass : 17.031 g/mol
Love how the subject is chemistry HAHA. I live in FL :/
Answers a
Explanation
Because it removes all the energy in the form of heat
A catalyst reduces H°rnx in most reactions. The answer is false
<h3>Do catalysts reduce delta H?</h3>
By reducing the activation energy required for the reaction to occur, a catalyst just modifies the route used to go from reactants to products. However, because it doesn't alter the state of the products or reactants, delta H is unaffected.
A catalyst reduces a reaction's activation energy, enabling a chemical reaction to occur. The number of reactant particles with energy above the activation energy increases as the temperature of a reaction rises.
learn more about catalyst refer
brainly.com/question/12507566
#SPJ4
Hello)
1)CH3-CH(OH)-СН2-СН2-СН2-СН2-СН3---(H2SO4)--›CH3-CH=CH-CH2-CH2-CH2-CH3+H2O
2)2-methyl-l-cyclohexanol---(h2so4)--›CH2=C(CH3)-CH2-CH2-CH2-CH2-CH3+H2O
