3 years ago

A 23.6 ml of slat water has a mass of 26.47 grams. calculate its density.

Chemistry

1 answer:

bija089 [108]3 years ago

7 0

The density is 1.12161 g/ml

You might be interested in

The four structures that both prokaryotic and eukaryotic cells have are

umka21 [38]

Hello! Greetings from Turkey! :)

* Cell membrane

* Cytoplasm

* DNA and RNA

* Ribosome

GOOD LUCK!!

8 0

3 years ago

Earth's atmosphere is made up of four different layers. In which of the following layers does virtually all of Earth's weather t

Lynna [10]

Troposphere, the first layer...
Hope this helps you!! :)
Brainliest?

7 0

3 years ago

When carbon is oxidized in a small amount of oxygen, the principle product formed is carbon monoxide (co). when the oxidation oc

skad [1K]

It generally does not mean that there is double the oxygen, but in this case there is double, because the subscript number tells how many atoms of that element are in a particle. In this case, there are two of the oxygen, hence the DI-oxide verbiage, and one of the carbon. When there is only one, it's MONOxide, to indicate only one atom.

6 0

3 years ago

Calculate ∆G ◦ r for the decomposition of mercury(II) oxide 2 HgO(s) → 2 Hg(ℓ) + O2(g) ∆H◦ f −90.83 − − (kJ · mol−1 ) ∆S ◦ m 70.

bagirrra123 [75]

Answer:

4. +117,1 kJ/mol

Explanation:

ΔG of a reaction is:

ΔGr = ΔHr - TΔSr (1)

For the reaction:

2 HgO(s) → 2 Hg(l) + O₂(g)

ΔHr: 2ΔHf Hg(l) + ΔHf O₂(g) - 2ΔHf HgO(s)

As ΔHf of Hg(l) and ΔHf O₂(g) are 0:

ΔHr: - 2ΔHf HgO(s) = 181,66 kJ/mol

In the same way ΔSr is:

ΔSr= 2ΔS° Hg(l) + ΔS° O₂(g) - 2ΔS° HgO(s)

ΔSr= 2* 76,02J/Kmol + 205,14 J/Kmol - 2*70,19 J/Kmol

ΔSr= 216,8 J/Kmol = 0,216 kJ/Kmol

Thus, ΔGr at 298K is:

ΔGr = 181,66 kJ/mol - 298K*0,216kJ/Kmol

ΔGr = +117,3 kJ/mol ≈ 4. +117,1 kJ/mol

I hope it helps!

5 0

3 years ago

31. Adding an additional oxygen atom to 02 creates....

cricket20 [7]

It creates chlorofluorocarbons(CFCs) also would create biooxygen but in the multiple choice it only shows the CFCs

4 0

3 years ago