The condensed formula would be CH3-CH(CH4)-CH2-CH(CH4)-CH2-CH(CH4)-CH3. The molecular formula would be C10H25.
Answer:
58.9mL
Explanation:
Given parameters:
Initial volume = 34.3mL = 0.0343dm³
Initial concentration = 1.72mM = 1.72 x 10⁻³moldm⁻³
Final concentration = 1.00mM = 1 x 10⁻³ moldm⁻³
Unknown:
Final volume =?
Solution:
Often times, the concentration of a standard solution may have to be diluted to a lower one by adding distilled water. To find the find the final volume, we must recognize that the number of moles of the substance in initial and final solutions are the same.
Therefore;
C₁V₁ = C₂V₂
where C and V are concentration and 1 and 2 are initial and final states.
now input the variables;
1.72 x 10⁻³ x 0.0343 = 1 x 10⁻³ x V₂
V₂ = 0.0589dm³ = 58.9mL
Answer:
131.5 kJ
Explanation:
Let's consider the following reaction.
CaCO₃(s) → CaO(s) + CO₂(g)
First, we will calculate the standard enthalpy of the reaction (ΔH°).
ΔH° = 1 mol × ΔH°f(CaO(s)) + 1 mol × ΔH°f(CO₂(g)
) - 1 mol × ΔH°f(CaCO₃(s)
)
ΔH° = 1 mol × (-634.9 kJ/mol) + 1 mol × (-393.5 kJ/mol) - 1 mol × (-1207.6 kJ/mol)
ΔH° = 179.2 kJ
Then, we calculate the standard entropy of the reaction (ΔS°).
ΔS° = 1 mol × S°(CaO(s)) + 1 mol × S°(CO₂(g)
) - 1 mol × S°(CaCO₃(s)
)
ΔS° = 1 mol × (38.1 J/mol.K) + 1 mol × (213.8 J/mol.K) - 1 mol × (91.7 J/mol.K)
ΔS° = 160.2 J/K = 0.1602 kJ/K
Finally, we calculate the standard Gibbs free energy of the reaction at T = 25°C = 298 K.
ΔG° = ΔH° - T × ΔS°
ΔG° = 179.2 kJ - 298 K × 0.1602 kJ/K
ΔG° = 131.5 kJ
Hey there!:
density = 3.51 g/cm³
Volume = 0.0270 cm³
Therefore:
D = m / V
3.51 = m / 0.0270
m = 3.51 * 0.0270
m = 0.09477 g
F = (mass)(acceleration) = ma
m = 55 kg
Vi = 20 m/s
t = 0.5 s
Vf = 0 m/s (since she was put to rest)
a=(Vf-Vi)/t
a=(0-20)/5
a = 40 m/s^2 (decelerating)
F = ma = (55 kg)(40 m/s^2)
F = 2200 N
